| MolName | 3,4-dichloro-N-[(Z)-(3,4-dichlorophenyl)methylideneamino]aniline |
| MolecularFormula | C13H8N2Cl4 |
| Smiles | Clc(ccc(/C=N\Nc(cc1)cc(Cl)c1Cl)c1)c1Cl |
| InChI | InChI=1S/C13H8Cl4N2/c14-10-3-1-8(5-12(10)16)7-18-19-9-2-4-11(15)13(17)6-9/h1-7,19H |
| InChIK | QWZSEEDODRPGHV-UHFFFAOYSA-N |
| TotalMolweight | 334.033 |
| Molweight | 334.033 |
| MonoisotopicMass | 331.944156 |
| CLogP | 7.2649 |
| CLogS | -6.093 |
| H Acceptors | 2 |
| H Donors | 1 |
| TotalSurfaceArea | 230.92 |
| Relative PSA | 0.099472 |
| PolarSurfaceArea | 24.39 |
| Druglikeness | 2.3845 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | low |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.68421 |
| Fragments | 1 |
| Non HAtoms | 19 |
| NonCHAtoms | 6 |
| Electronegative Atoms | 6 |
| Rotatable Bond | 3 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| StereoCon |
Click to Load Molecule:
1 - 3,4-dichloro-N-[(Z)-(3,4-dichlorophenyl)methylideneamino]aniline | 2 - 3,4-dichloro-N-[(Z)-(3,4-dichlorophenyl)methylideneamino]aniline