| MolName | 1-(2-hydroxyethyl)-3-phenyl-1-[(Z)-(3-phenyl-1,4-benzodioxin-2-yl)methylideneamino]thiourea |
| MolecularFormula | C24H21N3O3S |
| Smiles | OCCN(C(Nc1ccccc1)=S)/N=C\C1=C(c2ccccc2)Oc(cccc2)c2O1 |
| InChI | InChI=1S/C24H21N3O3S/c28-16-15-27(24(31)26-19-11-5-2-6-12-19)25-17-22-23(18-9-3-1-4-10-18)30-21-14-8-7-13-20(21)29-22/h1-14,17,28H,15-16H2,(H,26,31) |
| InChIK | QXJUHCITQJFUJC-UHFFFAOYSA-N |
| TotalMolweight | 431.515 |
| Molweight | 431.515 |
| MonoisotopicMass | 431.130362 |
| CLogP | 4.3885 |
| CLogS | -5.193 |
| H Acceptors | 6 |
| H Donors | 2 |
| TotalSurfaceArea | 335.3 |
| Relative PSA | 0.26132 |
| PolarSurfaceArea | 98.41 |
| Druglikeness | 3.5103 |
| Mutagenic | high |
| Tumorigenic | none |
| Reproductive Effective | high |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde; thio-amide/urea |
| Shape Index | 0.48387 |
| Fragments | 1 |
| Non HAtoms | 31 |
| NonCHAtoms | 7 |
| Electronegative Atoms | 7 |
| Rotatable Bond | 6 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Sp3Atoms | 6 |
| Symmetricatoms | 4 |
| StereoCon |
Click to Load Molecule:
1 - 1-(2-hydroxyethyl)-3-phenyl-1-[(Z)-(3-phenyl-1,4-benzodioxin-2-yl)methylideneamino]thiourea | 2 - 1-(2-hydroxyethyl)-3-phenyl-1-[(Z)-(3-phenyl-1,4-benzodioxin-2-yl)methylideneamino]thiourea