| MolName | 1-[1-[(Z)-benzylideneamino]-4-(furan-2-yl)imidazol-2-yl]-3-(2-chlorophenyl)urea |
| MolecularFormula | C21H16N5O2Cl |
| Smiles | O=C(Nc1nc(-c2ccco2)cn1/N=C\c1ccccc1)Nc(cccc1)c1Cl |
| InChI | InChI=1S/C21H16ClN5O2/c22-16-9-4-5-10-17(16)25-21(28)26-20-24-18(19-11-6-12-29-19)14-27(20)23-13-15-7-2-1-3-8-15/h1-14H,(H2,24,25,26,28) |
| InChIK | QXYKHYHFDWMCRK-UHFFFAOYSA-N |
| TotalMolweight | 405.844 |
| Molweight | 405.844 |
| MonoisotopicMass | 405.099252 |
| CLogP | 4.7114 |
| CLogS | -8.338 |
| H Acceptors | 7 |
| H Donors | 2 |
| TotalSurfaceArea | 311.04 |
| Relative PSA | 0.25534 |
| PolarSurfaceArea | 84.45 |
| Druglikeness | 4.4643 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | low |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.51724 |
| Fragments | 1 |
| Non HAtoms | 29 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 5 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 22 |
| Symmetricatoms | 2 |
| Amides | 2 |
| Aromatic Nitrogens | 2 |
| BasicNitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 1-[1-[(Z)-benzylideneamino]-4-(furan-2-yl)imidazol-2-yl]-3-(2-chlorophenyl)urea | 2 - 1-[1-[(Z)-benzylideneamino]-4-(furan-2-yl)imidazol-2-yl]-3-(2-chlorophenyl)urea