| MolName | [4-[(Z)-[(2-naphthalen-1-ylacetyl)hydrazinylidene]methyl]phenyl] 2-bromobenzoate |
| MolecularFormula | C26H19N2O3Br |
| Smiles | O=C(Cc1cccc2ccccc12)N/N=C\c(cc1)ccc1OC(c(cccc1)c1Br)=O |
| InChI | InChI=1S/C26H19BrN2O3/c27-24-11-4-3-10-23(24)26(31)32-21-14-12-18(13-15-21)17-28-29-25(30)16-20-8-5-7-19-6-1-2-9-22(19)20/h1-15,17H,16H2,(H,29,30) |
| InChIK | QXYQBHBHLGTVMP-UHFFFAOYSA-N |
| TotalMolweight | 487.352 |
| Molweight | 487.352 |
| MonoisotopicMass | 486.057904 |
| CLogP | 6.5498 |
| CLogS | -7.596 |
| H Acceptors | 5 |
| H Donors | 1 |
| TotalSurfaceArea | 341.49 |
| Relative PSA | 0.17292 |
| PolarSurfaceArea | 67.76 |
| Druglikeness | 2.239 |
| Mutagenic | none |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.625 |
| Fragments | 1 |
| Non HAtoms | 32 |
| NonCHAtoms | 6 |
| Electronegative Atoms | 6 |
| Rotatable Bond | 7 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 22 |
| Sp3Atoms | 2 |
| Symmetricatoms | 2 |
| StereoCon |
Click to Load Molecule:
1 - [4-[(Z)-[(2-naphthalen-1-ylacetyl)hydrazinylidene]methyl]phenyl] 2-bromobenzoate | 2 - [4-[(Z)-[(2-naphthalen-1-ylacetyl)hydrazinylidene]methyl]phenyl] 2-bromobenzoate