| MolName | 2-[2-[(Z)-[4-(4-chlorophenyl)piperazin-1-yl]iminomethyl]phenoxy]acetic acid |
| MolecularFormula | C19H20N3O3Cl |
| Smiles | OC(COc1c(/C=N\N(CC2)CCN2c(cc2)ccc2Cl)cccc1)=O |
| InChI | InChI=1S/C19H20ClN3O3/c20-16-5-7-17(8-6-16)22-9-11-23(12-10-22)21-13-15-3-1-2-4-18(15)26-14-19(24)25/h1-8,13H,9-12,14H2,(H,24,25) |
| InChIK | QYDWXDOTHCLNMX-UHFFFAOYSA-N |
| TotalMolweight | 373.839 |
| Molweight | 373.839 |
| MonoisotopicMass | 373.119319 |
| CLogP | 2.7621 |
| CLogS | -3.707 |
| H Acceptors | 6 |
| H Donors | 1 |
| TotalSurfaceArea | 283.2 |
| Relative PSA | 0.19333 |
| PolarSurfaceArea | 65.37 |
| Druglikeness | 5.9552 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.65385 |
| Fragments | 1 |
| Non HAtoms | 26 |
| NonCHAtoms | 7 |
| Electronegative Atoms | 7 |
| Rotatable Bond | 6 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 8 |
| Symmetricatoms | 4 |
| Amines | 1 |
| Aromatic Amines | 1 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 2-[2-[(Z)-[4-(4-chlorophenyl)piperazin-1-yl]iminomethyl]phenoxy]acetic acid | 2 - 2-[2-[(Z)-[4-(4-chlorophenyl)piperazin-1-yl]iminomethyl]phenoxy]acetic acid