| MolName | 5-chloro-2-hydroxy-N-[(Z)-(2,3,4,5,6-pentafluorophenyl)methylideneamino]benzamide |
| MolecularFormula | C14H6N2O2ClF5 |
| Smiles | Oc(ccc(Cl)c1)c1C(N/N=C\c(c(F)c(c(F)c1F)F)c1F)=O |
| InChI | InChI=1S/C14H6ClF5N2O2/c15-5-1-2-8(23)6(3-5)14(24)22-21-4-7-9(16)11(18)13(20)12(19)10(7)17/h1-4,23H,(H,22,24) |
| InChIK | QYKCOOVKDASDIW-UHFFFAOYSA-N |
| TotalMolweight | 364.657 |
| Molweight | 364.657 |
| MonoisotopicMass | 364.003795 |
| CLogP | 3.9659 |
| CLogS | -5.731 |
| H Acceptors | 4 |
| H Donors | 2 |
| TotalSurfaceArea | 240.51 |
| Relative PSA | 0.20419 |
| PolarSurfaceArea | 61.69 |
| Druglikeness | 3.0898 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde; polyhalo aromatic ring |
| Shape Index | 0.54167 |
| Fragments | 1 |
| Non HAtoms | 24 |
| NonCHAtoms | 10 |
| Electronegative Atoms | 10 |
| Rotatable Bond | 3 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 1 |
| Symmetricatoms | 4 |
| StereoCon |
Click to Load Molecule:
1 - 5-chloro-2-hydroxy-N-[(Z)-(2,3,4,5,6-pentafluorophenyl)methylideneamino]benzamide | 2 - 5-chloro-2-hydroxy-N-[(Z)-(2,3,4,5,6-pentafluorophenyl)methylideneamino]benzamide