| MolName | 3-[(Z)-(quinolin-8-ylhydrazinylidene)methyl]phenol |
| MolecularFormula | C16H13N3O |
| Smiles | Oc1cc(/C=N\Nc2cccc3cccnc23)ccc1 |
| InChI | InChI=1S/C16H13N3O/c20-14-7-1-4-12(10-14)11-18-19-15-8-2-5-13-6-3-9-17-16(13)15/h1-11,19-20H |
| InChIK | QZWAXTKQEOEKLZ-UHFFFAOYSA-N |
| TotalMolweight | 263.299 |
| Molweight | 263.299 |
| MonoisotopicMass | 263.105862 |
| CLogP | 4.8112 |
| CLogS | -3.559 |
| H Acceptors | 4 |
| H Donors | 2 |
| TotalSurfaceArea | 208.95 |
| Relative PSA | 0.22513 |
| PolarSurfaceArea | 57.51 |
| Druglikeness | 2.1702 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.6 |
| Fragments | 1 |
| Non HAtoms | 20 |
| NonCHAtoms | 4 |
| Electronegative Atoms | 4 |
| Rotatable Bond | 3 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 16 |
| Sp3Atoms | 1 |
| Aromatic Nitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 3-[(Z)-(quinolin-8-ylhydrazinylidene)methyl]phenol | 2 - 3-[(Z)-(quinolin-8-ylhydrazinylidene)methyl]phenol