| MolName | 2-[(Z)-[5-(4-bromophenyl)furan-2-yl]methylideneamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carbonitrile |
| MolecularFormula | C20H15N2OBrS |
| Smiles | N#Cc1c(/N=C\c2ccc(-c(cc3)ccc3Br)o2)sc2c1CCCC2 |
| InChI | InChI=1S/C20H15BrN2OS/c21-14-7-5-13(6-8-14)18-10-9-15(24-18)12-23-20-17(11-22)16-3-1-2-4-19(16)25-20/h5-10,12H,1-4H2 |
| InChIK | QZWYETDIHRZMDY-UHFFFAOYSA-N |
| TotalMolweight | 411.322 |
| Molweight | 411.322 |
| MonoisotopicMass | 410.008844 |
| CLogP | 5.7461 |
| CLogS | -7.477 |
| H Acceptors | 3 |
| TotalSurfaceArea | 285.05 |
| Relative PSA | 0.20888 |
| PolarSurfaceArea | 77.53 |
| Druglikeness | -7.3129 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.6 |
| Fragments | 1 |
| Non HAtoms | 25 |
| NonCHAtoms | 5 |
| Electronegative Atoms | 5 |
| Rotatable Bond | 3 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 16 |
| Sp3Atoms | 4 |
| Symmetricatoms | 2 |
| StereoCon |
Click to Load Molecule:
1 - 2-[(Z)-[5-(4-bromophenyl)furan-2-yl]methylideneamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carbonitrile | 2 - 2-[(Z)-[5-(4-bromophenyl)furan-2-yl]methylideneamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carbonitrile