| MolName | (1S,2S,6R,7R)-4-[(Z)-[2-[(4-chlorophenyl)methoxy]naphthalen-1-yl]methylideneamino]-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
| MolecularFormula | C27H21N2O3Cl |
| Smiles | O=C([C@H]([C@H]1C=C[C@@H]2C1)[C@H]2C1=O)N1/N=C\c(c1ccccc1cc1)c1OCc(cc1)ccc1Cl |
| InChI | InChI=1S/C27H21ClN2O3/c28-20-10-5-16(6-11-20)15-33-23-12-9-17-3-1-2-4-21(17)22(23)14-29-30-26(31)24-18-7-8-19(13-18)25(24)27(30)32/h1-12,14,18-19,24-25H,13,15H2/t18-,19-,24-,25+/m1/s1 |
| InChIK | RACGFZKTFLBFCJ-UEUXDIAVSA-N |
| TotalMolweight | 456.928 |
| Molweight | 456.928 |
| MonoisotopicMass | 456.12407 |
| CLogP | 4.887 |
| CLogS | -6.951 |
| H Acceptors | 5 |
| TotalSurfaceArea | 327.12 |
| Relative PSA | 0.15633 |
| PolarSurfaceArea | 58.97 |
| Druglikeness | 4.5093 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | high |
| Irritant | low |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.48485 |
| Fragments | 1 |
| Non HAtoms | 33 |
| NonCHAtoms | 6 |
| Electronegative Atoms | 6 |
| StereoCenters | 4 |
| Rotatable Bond | 5 |
| Rings Closures | 6 |
| Small Rings | 7 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 16 |
| Sp3Atoms | 7 |
| Symmetricatoms | 2 |
| StereoCon | this enantiomer |
Click to Load Molecule:
1 - (1S,2S,6R,7R)-4-[(Z)-[2-[(4-chlorophenyl)methoxy]naphthalen-1-yl]methylideneamino]-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione | 2 - (1S,2S,6R,7R)-4-[(Z)-[2-[(4-chlorophenyl)methoxy]naphthalen-1-yl]methylideneamino]-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione