| MolName | [4-[(Z)-[(3-chloro-1-benzothiophene-2-carbonyl)hydrazinylidene]methyl]phenyl] thiophene-2-carboxylate |
| MolecularFormula | C21H13N2O3ClS2 |
| Smiles | O=C(c(sc1c2cccc1)c2Cl)N/N=C\c(cc1)ccc1OC(c1cccs1)=O |
| InChI | InChI=1S/C21H13ClN2O3S2/c22-18-15-4-1-2-5-16(15)29-19(18)20(25)24-23-12-13-7-9-14(10-8-13)27-21(26)17-6-3-11-28-17/h1-12H,(H,24,25) |
| InChIK | RADHWCXPJLCUEM-UHFFFAOYSA-N |
| TotalMolweight | 440.93 |
| Molweight | 440.93 |
| MonoisotopicMass | 440.00561 |
| CLogP | 6.0259 |
| CLogS | -7.286 |
| H Acceptors | 5 |
| H Donors | 1 |
| TotalSurfaceArea | 316.4 |
| Relative PSA | 0.31533 |
| PolarSurfaceArea | 124.24 |
| Druglikeness | 6.0191 |
| Mutagenic | high |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde; 3-halo-enone |
| Shape Index | 0.62069 |
| Fragments | 1 |
| Non HAtoms | 29 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 6 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 20 |
| Sp3Atoms | 1 |
| Symmetricatoms | 2 |
| StereoCon |
Click to Load Molecule:
1 - [4-[(Z)-[(3-chloro-1-benzothiophene-2-carbonyl)hydrazinylidene]methyl]phenyl] thiophene-2-carboxylate | 2 - [4-[(Z)-[(3-chloro-1-benzothiophene-2-carbonyl)hydrazinylidene]methyl]phenyl] thiophene-2-carboxylate