| MolName | 2-[2-chloro-4-[(Z)-[[2-(2,4-dichlorophenoxy)acetyl]hydrazinylidene]methyl]phenoxy]acetic acid |
| MolecularFormula | C17H13N2O5Cl3 |
| Smiles | OC(COc(ccc(/C=N\NC(COc(ccc(Cl)c1)c1Cl)=O)c1)c1Cl)=O |
| InChI | InChI=1S/C17H13Cl3N2O5/c18-11-2-4-15(13(20)6-11)26-8-16(23)22-21-7-10-1-3-14(12(19)5-10)27-9-17(24)25/h1-7H,8-9H2,(H,22,23)(H,24,25) |
| InChIK | RAJAAPXNYNNWLA-UHFFFAOYSA-N |
| TotalMolweight | 431.658 |
| Molweight | 431.658 |
| MonoisotopicMass | 429.989004 |
| CLogP | 3.6545 |
| CLogS | -5.502 |
| H Acceptors | 7 |
| H Donors | 2 |
| TotalSurfaceArea | 304.87 |
| Relative PSA | 0.26946 |
| PolarSurfaceArea | 97.22 |
| Druglikeness | 4.2452 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | high |
| Irritant | high |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.7037 |
| Fragments | 1 |
| Non HAtoms | 27 |
| NonCHAtoms | 10 |
| Electronegative Atoms | 10 |
| Rotatable Bond | 8 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 5 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 2-[2-chloro-4-[(Z)-[[2-(2,4-dichlorophenoxy)acetyl]hydrazinylidene]methyl]phenoxy]acetic acid | 2 - 2-[2-chloro-4-[(Z)-[[2-(2,4-dichlorophenoxy)acetyl]hydrazinylidene]methyl]phenoxy]acetic acid