| MolName | N-[(Z)-(3-hydroxyphenyl)methylideneamino]-3-(2-phenylmethoxyphenyl)-1H-pyrazole-5-carboxamide |
| MolecularFormula | C24H20N4O3 |
| Smiles | Oc1cccc(/C=N\NC(c2cc(-c(cccc3)c3OCc3ccccc3)n[nH]2)=O)c1 |
| InChI | InChI=1S/C24H20N4O3/c29-19-10-6-9-18(13-19)15-25-28-24(30)22-14-21(26-27-22)20-11-4-5-12-23(20)31-16-17-7-2-1-3-8-17/h1-15,29H,16H2,(H,26,27)(H,28,30) |
| InChIK | RATNVSIISASRRT-UHFFFAOYSA-N |
| TotalMolweight | 412.448 |
| Molweight | 412.448 |
| MonoisotopicMass | 412.153541 |
| CLogP | 3.9018 |
| CLogS | -5.141 |
| H Acceptors | 7 |
| H Donors | 3 |
| TotalSurfaceArea | 324.95 |
| Relative PSA | 0.25872 |
| PolarSurfaceArea | 99.6 |
| Druglikeness | 5.325 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.6129 |
| Fragments | 1 |
| Non HAtoms | 31 |
| NonCHAtoms | 7 |
| Electronegative Atoms | 7 |
| Rotatable Bond | 7 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 23 |
| Sp3Atoms | 3 |
| Symmetricatoms | 2 |
| Aromatic Nitrogens | 2 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-(3-hydroxyphenyl)methylideneamino]-3-(2-phenylmethoxyphenyl)-1H-pyrazole-5-carboxamide | 2 - N-[(Z)-(3-hydroxyphenyl)methylideneamino]-3-(2-phenylmethoxyphenyl)-1H-pyrazole-5-carboxamide