| MolName | N-[(Z)-(4-nitrophenyl)methylideneamino]-2-(1,4,5,6-tetrahydropyrimidin-2-yl)benzamide |
| MolecularFormula | C18H17N5O3 |
| Smiles | [O-][N+](c1ccc(/C=N\NC(c(cccc2)c2C2=NCCCN2)=O)cc1)=O |
| InChI | InChI=1S/C18H17N5O3/c24-18(22-21-12-13-6-8-14(9-7-13)23(25)26)16-5-2-1-4-15(16)17-19-10-3-11-20-17/h1-2,4-9,12H,3,10-11H2,(H,19,20)(H,22,24) |
| InChIK | RAUHRBHRYKKFBX-UHFFFAOYSA-N |
| TotalMolweight | 351.365 |
| Molweight | 351.365 |
| MonoisotopicMass | 351.13314 |
| CLogP | 1.9339 |
| CLogS | -4.658 |
| H Acceptors | 8 |
| H Donors | 2 |
| TotalSurfaceArea | 272.87 |
| Relative PSA | 0.32763 |
| PolarSurfaceArea | 111.67 |
| Druglikeness | 0.52247 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | aromatic nitro; acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.61538 |
| Fragments | 1 |
| Non HAtoms | 26 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 5 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 4 |
| Symmetricatoms | 2 |
| BasicNitrogens | 1 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-(4-nitrophenyl)methylideneamino]-2-(1,4,5,6-tetrahydropyrimidin-2-yl)benzamide | 2 - N-[(Z)-(4-nitrophenyl)methylideneamino]-2-(1,4,5,6-tetrahydropyrimidin-2-yl)benzamide