| MolName | 2-(4-chlorophenoxy)-N-[(Z)-(3-fluorophenyl)methylideneamino]acetamide |
| MolecularFormula | C15H12N2O2ClF |
| Smiles | O=C(COc(cc1)ccc1Cl)N/N=C\c1cc(F)ccc1 |
| InChI | InChI=1S/C15H12ClFN2O2/c16-12-4-6-14(7-5-12)21-10-15(20)19-18-9-11-2-1-3-13(17)8-11/h1-9H,10H2,(H,19,20) |
| InChIK | RCLZRXWAKVKNNT-UHFFFAOYSA-N |
| TotalMolweight | 306.723 |
| Molweight | 306.723 |
| MonoisotopicMass | 306.057133 |
| CLogP | 3.4833 |
| CLogS | -4.551 |
| H Acceptors | 4 |
| H Donors | 1 |
| TotalSurfaceArea | 232.52 |
| Relative PSA | 0.19788 |
| PolarSurfaceArea | 50.69 |
| Druglikeness | 2.8878 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | high |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.71429 |
| Fragments | 1 |
| Non HAtoms | 21 |
| NonCHAtoms | 6 |
| Electronegative Atoms | 6 |
| Rotatable Bond | 5 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 2 |
| Symmetricatoms | 2 |
| StereoCon |
Click to Load Molecule:
1 - 2-(4-chlorophenoxy)-N-[(Z)-(3-fluorophenyl)methylideneamino]acetamide | 2 - 2-(4-chlorophenoxy)-N-[(Z)-(3-fluorophenyl)methylideneamino]acetamide