| MolName | 3-N-[(Z)-[5-(2,4-dichlorophenyl)furan-2-yl]methylideneamino]-1,2,4-triazole-3,4-diamine |
| MolecularFormula | C13H10N6OCl2 |
| Smiles | Nn1c(N/N=C\c2ccc(-c(ccc(Cl)c3)c3Cl)o2)nnc1 |
| InChI | InChI=1S/C13H10Cl2N6O/c14-8-1-3-10(11(15)5-8)12-4-2-9(22-12)6-17-19-13-20-18-7-21(13)16/h1-7H,16H2,(H,19,20) |
| InChIK | RCOKFHBHAAWSRW-UHFFFAOYSA-N |
| TotalMolweight | 337.169 |
| Molweight | 337.169 |
| MonoisotopicMass | 336.029313 |
| CLogP | 5.1537 |
| CLogS | -7.686 |
| H Acceptors | 7 |
| H Donors | 2 |
| TotalSurfaceArea | 244.77 |
| Relative PSA | 0.33158 |
| PolarSurfaceArea | 94.26 |
| Druglikeness | 3.9618 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | low |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.63636 |
| Fragments | 1 |
| Non HAtoms | 22 |
| NonCHAtoms | 9 |
| Electronegative Atoms | 9 |
| Rotatable Bond | 4 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 16 |
| Sp3Atoms | 1 |
| Aromatic Nitrogens | 3 |
| BasicNitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 3-N-[(Z)-[5-(2,4-dichlorophenyl)furan-2-yl]methylideneamino]-1,2,4-triazole-3,4-diamine | 2 - 3-N-[(Z)-[5-(2,4-dichlorophenyl)furan-2-yl]methylideneamino]-1,2,4-triazole-3,4-diamine