| MolName | [4-[(Z)-[[6-amino-9-[(2S,3S,4R,5S)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]purin-8-yl]hydrazinylidene]methyl]phenyl] furan-2-carboxylate |
| MolecularFormula | C22H21N7O7 |
| Smiles | Nc1ncnc2c1nc(N/N=C\c(cc1)ccc1OC(c1ccco1)=O)n2[C@H]([C@H]1O)O[C@@H](CO)[C@@H]1O |
| InChI | InChI=1S/C22H21N7O7/c23-18-15-19(25-10-24-18)29(20-17(32)16(31)14(9-30)36-20)22(27-15)28-26-8-11-3-5-12(6-4-11)35-21(33)13-2-1-7-34-13/h1-8,10,14,16-17,20,30-32H,9H2,(H,27,28)(H2,23,24,25)/t14-,16-,17+,20+/m1/s1 |
| InChIK | RCZVONGVPOGWCT-PYQAKABTSA-N |
| TotalMolweight | 495.451 |
| Molweight | 495.451 |
| MonoisotopicMass | 495.150248 |
| CLogP | 2.4304 |
| CLogS | -5.281 |
| H Acceptors | 14 |
| H Donors | 5 |
| TotalSurfaceArea | 354.35 |
| Relative PSA | 0.46415 |
| PolarSurfaceArea | 203.37 |
| Druglikeness | 1.9999 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.52778 |
| Fragments | 1 |
| Non HAtoms | 36 |
| NonCHAtoms | 14 |
| Electronegative Atoms | 14 |
| StereoCenters | 4 |
| Rotatable Bond | 8 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 20 |
| Sp3Atoms | 10 |
| Symmetricatoms | 2 |
| Aromatic Nitrogens | 4 |
| BasicNitrogens | 1 |
| StereoCon | this enantiomer |
Click to Load Molecule:
1 - [4-[(Z)-[[6-amino-9-[(2S,3S,4R,5S)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]purin-8-yl]hydrazinylidene]methyl]phenyl] furan-2-carboxylate | 2 - [4-[(Z)-[[6-amino-9-[(2S,3S,4R,5S)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]purin-8-yl]hydrazinylidene]methyl]phenyl] furan-2-carboxylate