| MolName | N-[(Z)-[(5Z)-5-(furan-2-carbonylhydrazinylidene)pentylidene]amino]furan-2-carboxamide |
| MolecularFormula | C15H16N4O4 |
| Smiles | O=C(c1ccco1)N/N=C\CCC/C=N\NC(c1ccco1)=O |
| InChI | InChI=1S/C15H16N4O4/c20-14(12-6-4-10-22-12)18-16-8-2-1-3-9-17-19-15(21)13-7-5-11-23-13/h4-11H,1-3H2,(H,18,20)(H,19,21) |
| InChIK | RDEFVBLEGHGYTM-UHFFFAOYSA-N |
| TotalMolweight | 316.316 |
| Molweight | 316.316 |
| MonoisotopicMass | 316.117156 |
| CLogP | 1.6572 |
| CLogS | -4.136 |
| H Acceptors | 8 |
| H Donors | 2 |
| TotalSurfaceArea | 261.62 |
| Relative PSA | 0.38315 |
| PolarSurfaceArea | 109.2 |
| Druglikeness | 1.3821 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.73913 |
| Fragments | 1 |
| Non HAtoms | 23 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 8 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 10 |
| Sp3Atoms | 3 |
| Symmetricatoms | 11 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-[(5Z)-5-(furan-2-carbonylhydrazinylidene)pentylidene]amino]furan-2-carboxamide | 2 - N-[(Z)-[(5Z)-5-(furan-2-carbonylhydrazinylidene)pentylidene]amino]furan-2-carboxamide