| MolName | 3-(2,4-dichlorophenyl)-4-[(Z)-(3-nitro-4-pyrrolidin-1-ylphenyl)methylideneamino]-1H-1,2,4-triazole-5-thione |
| MolecularFormula | C19H16N6O2Cl2S |
| Smiles | [O-][N+](c(cc(/C=N\N(C(c(ccc(Cl)c1)c1Cl)=NN1)C1=S)cc1)c1N1CCCC1)=O |
| InChI | InChI=1S/C19H16Cl2N6O2S/c20-13-4-5-14(15(21)10-13)18-23-24-19(30)26(18)22-11-12-3-6-16(17(9-12)27(28)29)25-7-1-2-8-25/h3-6,9-11H,1-2,7-8H2,(H,24,30) |
| InChIK | RDEYRYRIRBZOEY-UHFFFAOYSA-N |
| TotalMolweight | 463.348 |
| Molweight | 463.348 |
| MonoisotopicMass | 462.043248 |
| CLogP | 4.0764 |
| CLogS | -7.105 |
| H Acceptors | 8 |
| H Donors | 1 |
| TotalSurfaceArea | 328.07 |
| Relative PSA | 0.30481 |
| PolarSurfaceArea | 121.14 |
| Druglikeness | -0.22754 |
| Mutagenic | high |
| Tumorigenic | none |
| Reproductive Effective | high |
| Irritant | none |
| Nasty Functions | aromatic nitro; imine/hydrazone of aldehyde; thio-amide/urea |
| Shape Index | 0.53333 |
| Fragments | 1 |
| Non HAtoms | 30 |
| NonCHAtoms | 11 |
| Electronegative Atoms | 11 |
| Rotatable Bond | 5 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 7 |
| Symmetricatoms | 2 |
| Amines | 1 |
| Aromatic Amines | 1 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 3-(2,4-dichlorophenyl)-4-[(Z)-(3-nitro-4-pyrrolidin-1-ylphenyl)methylideneamino]-1H-1,2,4-triazole-5-thione | 2 - 3-(2,4-dichlorophenyl)-4-[(Z)-(3-nitro-4-pyrrolidin-1-ylphenyl)methylideneamino]-1H-1,2,4-triazole-5-thione