| MolName | N-[2-[(2Z)-2-[(3-bromophenyl)methylidene]hydrazinyl]-2-oxoethyl]-3-fluorobenzamide |
| MolecularFormula | C16H13N3O2BrF |
| Smiles | O=C(CNC(c1cc(F)ccc1)=O)N/N=C\c1cccc(Br)c1 |
| InChI | InChI=1S/C16H13BrFN3O2/c17-13-5-1-3-11(7-13)9-20-21-15(22)10-19-16(23)12-4-2-6-14(18)8-12/h1-9H,10H2,(H,19,23)(H,21,22) |
| InChIK | RDGCEALXORBJSU-UHFFFAOYSA-N |
| TotalMolweight | 378.2 |
| Molweight | 378.2 |
| MonoisotopicMass | 377.017516 |
| CLogP | 3.1113 |
| CLogS | -4.636 |
| H Acceptors | 5 |
| H Donors | 2 |
| TotalSurfaceArea | 254.94 |
| Relative PSA | 0.23735 |
| PolarSurfaceArea | 70.56 |
| Druglikeness | 2.1987 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.65217 |
| Fragments | 1 |
| Non HAtoms | 23 |
| NonCHAtoms | 7 |
| Electronegative Atoms | 7 |
| Rotatable Bond | 5 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 1 |
| Amides | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-[2-[(2Z)-2-[(3-bromophenyl)methylidene]hydrazinyl]-2-oxoethyl]-3-fluorobenzamide | 2 - N-[2-[(2Z)-2-[(3-bromophenyl)methylidene]hydrazinyl]-2-oxoethyl]-3-fluorobenzamide