| MolName | (Z)-1-[1-[(2,6-dichlorophenyl)methyl]indol-3-yl]-N-[(Z)-[1-[(2,6-dichlorophenyl)methyl]indol-3-yl]methylideneamino]methanimine |
| MolecularFormula | C32H22N4Cl4 |
| Smiles | Clc1cccc(Cl)c1Cn1c(cccc2)c2c(/C=N\N=C/c2cn(Cc(c(Cl)ccc3)c3Cl)c3c2cccc3)c1 |
| InChI | InChI=1S/C32H22Cl4N4/c33-27-9-5-10-28(34)25(27)19-39-17-21(23-7-1-3-13-31(23)39)15-37-38-16-22-18-40(32-14-4-2-8-24(22)32)20-26-29(35)11-6-12-30(26)36/h1-18H,19-20H2 |
| InChIK | RDKGPVHIBRQABA-UHFFFAOYSA-N |
| TotalMolweight | 604.367 |
| Molweight | 604.367 |
| MonoisotopicMass | 602.059854 |
| CLogP | 10.269 |
| CLogS | -9.032 |
| H Acceptors | 4 |
| TotalSurfaceArea | 438.86 |
| Relative PSA | 0.083762 |
| PolarSurfaceArea | 34.58 |
| Druglikeness | 4.0862 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | dimethylene-hydrazine; imine/hydrazone of aldehyde |
| Shape Index | 0.5 |
| Fragments | 1 |
| Non HAtoms | 40 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 7 |
| Rings Closures | 6 |
| Small Rings | 6 |
| Aromatic Rings | 6 |
| Aromatic Atoms | 30 |
| Sp3Atoms | 2 |
| Symmetricatoms | 23 |
| Aromatic Nitrogens | 2 |
| StereoCon |
Click to Load Molecule:
1 - (Z)-1-[1-[(2,6-dichlorophenyl)methyl]indol-3-yl]-N-[(Z)-[1-[(2,6-dichlorophenyl)methyl]indol-3-yl]methylideneamino]methanimine | 2 - (Z)-1-[1-[(2,6-dichlorophenyl)methyl]indol-3-yl]-N-[(Z)-[1-[(2,6-dichlorophenyl)methyl]indol-3-yl]methylideneamino]methanimine