| MolName | N-[(Z)-(5-morpholin-4-ylthiophen-2-yl)methylideneamino]thiophene-2-carboxamide |
| MolecularFormula | C14H15N3O2S2 |
| Smiles | O=C(c1cccs1)N/N=C\c1ccc(N2CCOCC2)s1 |
| InChI | InChI=1S/C14H15N3O2S2/c18-14(12-2-1-9-20-12)16-15-10-11-3-4-13(21-11)17-5-7-19-8-6-17/h1-4,9-10H,5-8H2,(H,16,18) |
| InChIK | RDWFYXKWJBLBFZ-UHFFFAOYSA-N |
| TotalMolweight | 321.424 |
| Molweight | 321.424 |
| MonoisotopicMass | 321.060567 |
| CLogP | 2.7934 |
| CLogS | -3.994 |
| H Acceptors | 5 |
| H Donors | 1 |
| TotalSurfaceArea | 240.71 |
| Relative PSA | 0.37506 |
| PolarSurfaceArea | 110.41 |
| Druglikeness | 6.8398 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.66667 |
| Fragments | 1 |
| Non HAtoms | 21 |
| NonCHAtoms | 7 |
| Electronegative Atoms | 7 |
| Rotatable Bond | 4 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 10 |
| Sp3Atoms | 5 |
| Symmetricatoms | 2 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-(5-morpholin-4-ylthiophen-2-yl)methylideneamino]thiophene-2-carboxamide | 2 - N-[(Z)-(5-morpholin-4-ylthiophen-2-yl)methylideneamino]thiophene-2-carboxamide