| MolName | [4-[(Z)-[[1-(4-amino-1,2,5-oxadiazol-3-yl)-5-(3,4-dihydro-2H-quinolin-1-ylmethyl)triazole-4-carbonyl]hydrazinylidene]methyl]phenyl] furan-2-carboxylate |
| MolecularFormula | C27H23N9O5 |
| Smiles | Nc1nonc1-n1nnc(C(N/N=C\c(cc2)ccc2OC(c2ccco2)=O)=O)c1CN(CCC1)c2c1cccc2 |
| InChI | InChI=1S/C27H23N9O5/c28-24-25(33-41-32-24)36-21(16-35-13-3-6-18-5-1-2-7-20(18)35)23(30-34-36)26(37)31-29-15-17-9-11-19(12-10-17)40-27(38)22-8-4-14-39-22/h1-2,4-5,7-12,14-15H,3,6,13,16H2,(H2,28,32)(H,31,37) |
| InChIK | RECMIVYJDQHDBJ-UHFFFAOYSA-N |
| TotalMolweight | 553.538 |
| Molweight | 553.538 |
| MonoisotopicMass | 553.182216 |
| CLogP | 4.1625 |
| CLogS | -4.582 |
| H Acceptors | 14 |
| H Donors | 2 |
| TotalSurfaceArea | 418 |
| Relative PSA | 0.37522 |
| PolarSurfaceArea | 179.79 |
| Druglikeness | 2.2341 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.5122 |
| Fragments | 1 |
| Non HAtoms | 41 |
| NonCHAtoms | 14 |
| Electronegative Atoms | 14 |
| Rotatable Bond | 9 |
| Rings Closures | 6 |
| Small Rings | 6 |
| Aromatic Rings | 5 |
| Aromatic Atoms | 27 |
| Sp3Atoms | 6 |
| Symmetricatoms | 2 |
| Amines | 1 |
| Aromatic Amines | 1 |
| Aromatic Nitrogens | 5 |
| StereoCon |
Click to Load Molecule:
1 - [4-[(Z)-[[1-(4-amino-1,2,5-oxadiazol-3-yl)-5-(3,4-dihydro-2H-quinolin-1-ylmethyl)triazole-4-carbonyl]hydrazinylidene]methyl]phenyl] furan-2-carboxylate | 2 - [4-[(Z)-[[1-(4-amino-1,2,5-oxadiazol-3-yl)-5-(3,4-dihydro-2H-quinolin-1-ylmethyl)triazole-4-carbonyl]hydrazinylidene]methyl]phenyl] furan-2-carboxylate