| MolName | 4-[(Z)-[[2-(3,5-dioxo-2H-1,2,4-triazin-6-yl)acetyl]hydrazinylidene]methyl]benzoic acid |
| MolecularFormula | C13H11N5O5 |
| Smiles | OC(c1ccc(/C=N\NC(CC(C(N2)=O)=NNC2=O)=O)cc1)=O |
| InChI | InChI=1S/C13H11N5O5/c19-10(5-9-11(20)15-13(23)18-16-9)17-14-6-7-1-3-8(4-2-7)12(21)22/h1-4,6H,5H2,(H,17,19)(H,21,22)(H2,15,18,20,23) |
| InChIK | REHQOEYTCGUGMB-UHFFFAOYSA-N |
| TotalMolweight | 317.26 |
| Molweight | 317.26 |
| MonoisotopicMass | 317.07602 |
| CLogP | -0.0413 |
| CLogS | -3.374 |
| H Acceptors | 10 |
| H Donors | 4 |
| TotalSurfaceArea | 232.98 |
| Relative PSA | 0.52648 |
| PolarSurfaceArea | 149.32 |
| Druglikeness | 6.9111 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.69565 |
| Fragments | 1 |
| Non HAtoms | 23 |
| NonCHAtoms | 10 |
| Electronegative Atoms | 10 |
| Rotatable Bond | 5 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 1 |
| Aromatic Atoms | 6 |
| Sp3Atoms | 2 |
| Symmetricatoms | 2 |
| Amides | 1 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 4-[(Z)-[[2-(3,5-dioxo-2H-1,2,4-triazin-6-yl)acetyl]hydrazinylidene]methyl]benzoic acid | 2 - 4-[(Z)-[[2-(3,5-dioxo-2H-1,2,4-triazin-6-yl)acetyl]hydrazinylidene]methyl]benzoic acid