| MolName | 4-[(Z)-[[2-[[4-(4-chlorophenyl)-5-pyridin-4-yl-1,2,4-triazol-3-yl]sulfanyl]acetyl]hydrazinylidene]methyl]benzoic acid |
| MolecularFormula | C23H17N6O3ClS |
| Smiles | OC(c1ccc(/C=N\NC(CSc2nnc(-c3ccncc3)n2-c(cc2)ccc2Cl)=O)cc1)=O |
| InChI | InChI=1S/C23H17ClN6O3S/c24-18-5-7-19(8-6-18)30-21(16-9-11-25-12-10-16)28-29-23(30)34-14-20(31)27-26-13-15-1-3-17(4-2-15)22(32)33/h1-13H,14H2,(H,27,31)(H,32,33) |
| InChIK | RERBGJCWKCHKGB-UHFFFAOYSA-N |
| TotalMolweight | 492.946 |
| Molweight | 492.946 |
| MonoisotopicMass | 492.077136 |
| CLogP | 3.622 |
| CLogS | -8.37 |
| H Acceptors | 9 |
| H Donors | 2 |
| TotalSurfaceArea | 362.76 |
| Relative PSA | 0.3292 |
| PolarSurfaceArea | 147.66 |
| Druglikeness | 5.274 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.55882 |
| Fragments | 1 |
| Non HAtoms | 34 |
| NonCHAtoms | 11 |
| Electronegative Atoms | 11 |
| Rotatable Bond | 8 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 23 |
| Sp3Atoms | 3 |
| Symmetricatoms | 6 |
| Aromatic Nitrogens | 4 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 4-[(Z)-[[2-[[4-(4-chlorophenyl)-5-pyridin-4-yl-1,2,4-triazol-3-yl]sulfanyl]acetyl]hydrazinylidene]methyl]benzoic acid | 2 - 4-[(Z)-[[2-[[4-(4-chlorophenyl)-5-pyridin-4-yl-1,2,4-triazol-3-yl]sulfanyl]acetyl]hydrazinylidene]methyl]benzoic acid