| MolName | 3-[[(Z)-benzylideneamino]sulfamoyl]-N-phenylbenzamide |
| MolecularFormula | C20H17N3O3S |
| Smiles | O=C(c1cccc(S(N/N=C\c2ccccc2)(=O)=O)c1)Nc1ccccc1 |
| InChI | InChI=1S/C20H17N3O3S/c24-20(22-18-11-5-2-6-12-18)17-10-7-13-19(14-17)27(25,26)23-21-15-16-8-3-1-4-9-16/h1-15,23H,(H,22,24) |
| InChIK | RFFLSHBUSAHBNR-UHFFFAOYSA-N |
| TotalMolweight | 379.439 |
| Molweight | 379.439 |
| MonoisotopicMass | 379.099062 |
| CLogP | 3.4246 |
| CLogS | -3.428 |
| H Acceptors | 6 |
| H Donors | 2 |
| TotalSurfaceArea | 286.79 |
| Relative PSA | 0.26518 |
| PolarSurfaceArea | 96.01 |
| Druglikeness | -2.5392 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.62963 |
| Fragments | 1 |
| Non HAtoms | 27 |
| NonCHAtoms | 7 |
| Electronegative Atoms | 7 |
| Rotatable Bond | 5 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Sp3Atoms | 1 |
| Symmetricatoms | 5 |
| Amides | 1 |
| StereoCon |
Click to Load Molecule:
1 - 3-[[(Z)-benzylideneamino]sulfamoyl]-N-phenylbenzamide | 2 - 3-[[(Z)-benzylideneamino]sulfamoyl]-N-phenylbenzamide