| MolName | N-[(Z)-(4-fluorophenyl)methylideneamino]-5H-[1,2,4]triazino[5,6-b]indol-3-amine |
| MolecularFormula | C16H11N6F |
| Smiles | Fc1ccc(/C=N\Nc2nnc(c(cccc3)c3[nH]3)c3n2)cc1 |
| InChI | InChI=1S/C16H11FN6/c17-11-7-5-10(6-8-11)9-18-22-16-20-15-14(21-23-16)12-3-1-2-4-13(12)19-15/h1-9H,(H2,19,20,22,23) |
| InChIK | RFIXAJNINOGPMR-UHFFFAOYSA-N |
| TotalMolweight | 306.303 |
| Molweight | 306.303 |
| MonoisotopicMass | 306.102922 |
| CLogP | 4.6808 |
| CLogS | -5.045 |
| H Acceptors | 6 |
| H Donors | 2 |
| TotalSurfaceArea | 230.64 |
| Relative PSA | 0.30294 |
| PolarSurfaceArea | 78.85 |
| Druglikeness | 1.2194 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.65217 |
| Fragments | 1 |
| Non HAtoms | 23 |
| NonCHAtoms | 7 |
| Electronegative Atoms | 7 |
| Rotatable Bond | 3 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 19 |
| Symmetricatoms | 2 |
| Aromatic Nitrogens | 4 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-(4-fluorophenyl)methylideneamino]-5H-[1,2,4]triazino[5,6-b]indol-3-amine | 2 - N-[(Z)-(4-fluorophenyl)methylideneamino]-5H-[1,2,4]triazino[5,6-b]indol-3-amine