| MolName | 3-[(Z)-[3-(4-chlorophenoxy)phenyl]methylideneamino]-2-sulfanylidene-1,3-thiazolidin-4-one |
| MolecularFormula | C16H11N2O2ClS2 |
| Smiles | O=C(CSC1=S)N1/N=C\c1cccc(Oc(cc2)ccc2Cl)c1 |
| InChI | InChI=1S/C16H11ClN2O2S2/c17-12-4-6-13(7-5-12)21-14-3-1-2-11(8-14)9-18-19-15(20)10-23-16(19)22/h1-9H,10H2 |
| InChIK | RFNDZLHFGGSDFK-UHFFFAOYSA-N |
| TotalMolweight | 362.86 |
| Molweight | 362.86 |
| MonoisotopicMass | 361.995045 |
| CLogP | 2.9434 |
| CLogS | -6.298 |
| H Acceptors | 4 |
| TotalSurfaceArea | 261.71 |
| Relative PSA | 0.3194 |
| PolarSurfaceArea | 99.29 |
| Druglikeness | 3.7655 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.6087 |
| Fragments | 1 |
| Non HAtoms | 23 |
| NonCHAtoms | 7 |
| Electronegative Atoms | 7 |
| Rotatable Bond | 4 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 4 |
| Symmetricatoms | 2 |
| StereoCon |
Click to Load Molecule:
1 - 3-[(Z)-[3-(4-chlorophenoxy)phenyl]methylideneamino]-2-sulfanylidene-1,3-thiazolidin-4-one | 2 - 3-[(Z)-[3-(4-chlorophenoxy)phenyl]methylideneamino]-2-sulfanylidene-1,3-thiazolidin-4-one