| MolName | 2-[[5-(naphthalen-1-ylmethylsulfanyl)-1,3,4-thiadiazol-2-yl]sulfanyl]-N-[(Z)-[4-(trifluoromethyl)phenyl]methylideneamino]acetamide |
| MolecularFormula | C23H17N4OF3S3 |
| Smiles | O=C(CSc1nnc(SCc2cccc3ccccc23)s1)N/N=C\c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C23H17F3N4OS3/c24-23(25,26)18-10-8-15(9-11-18)12-27-28-20(31)14-33-22-30-29-21(34-22)32-13-17-6-3-5-16-4-1-2-7-19(16)17/h1-12H,13-14H2,(H,28,31) |
| InChIK | RFYOKVZHEVBSME-UHFFFAOYSA-N |
| TotalMolweight | 518.607 |
| Molweight | 518.607 |
| MonoisotopicMass | 518.051655 |
| CLogP | 6.4557 |
| CLogS | -8.724 |
| H Acceptors | 5 |
| H Donors | 1 |
| TotalSurfaceArea | 366.77 |
| Relative PSA | 0.30889 |
| PolarSurfaceArea | 146.08 |
| Druglikeness | -2.0577 |
| Mutagenic | low |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.64706 |
| Fragments | 1 |
| Non HAtoms | 34 |
| NonCHAtoms | 11 |
| Electronegative Atoms | 11 |
| Rotatable Bond | 9 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 21 |
| Sp3Atoms | 5 |
| Symmetricatoms | 4 |
| Aromatic Nitrogens | 2 |
| StereoCon |
Click to Load Molecule:
1 - 2-[[5-(naphthalen-1-ylmethylsulfanyl)-1,3,4-thiadiazol-2-yl]sulfanyl]-N-[(Z)-[4-(trifluoromethyl)phenyl]methylideneamino]acetamide | 2 - 2-[[5-(naphthalen-1-ylmethylsulfanyl)-1,3,4-thiadiazol-2-yl]sulfanyl]-N-[(Z)-[4-(trifluoromethyl)phenyl]methylideneamino]acetamide