| MolName | 2-[(3,5-dioxo-2H-1,2,4-triazin-6-yl)amino]-N-[(E)-[2-(trifluoromethyl)phenyl]methylideneamino]acetamide |
| MolecularFormula | C13H11N6O3F3 |
| Smiles | O=C(CNC(C(N1)=O)=NNC1=O)N/N=C/c1c(C(F)(F)F)cccc1 |
| InChI | InChI=1S/C13H11F3N6O3/c14-13(15,16)8-4-2-1-3-7(8)5-18-20-9(23)6-17-10-11(24)19-12(25)22-21-10/h1-5H,6H2,(H,17,21)(H,20,23)(H2,19,22,24,25) |
| InChIK | RGJFQPZNXFVRMG-UHFFFAOYSA-N |
| TotalMolweight | 356.263 |
| Molweight | 356.263 |
| MonoisotopicMass | 356.084473 |
| CLogP | 0.1929 |
| CLogS | -3.714 |
| H Acceptors | 9 |
| H Donors | 4 |
| TotalSurfaceArea | 249.8 |
| Relative PSA | 0.43227 |
| PolarSurfaceArea | 124.05 |
| Druglikeness | -0.37213 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.6 |
| Fragments | 1 |
| Non HAtoms | 25 |
| NonCHAtoms | 12 |
| Electronegative Atoms | 12 |
| Rotatable Bond | 5 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 1 |
| Aromatic Atoms | 6 |
| Sp3Atoms | 2 |
| Symmetricatoms | 2 |
| Amides | 1 |
| StereoCon |
Click to Load Molecule:
1 - 2-[(3,5-dioxo-2H-1,2,4-triazin-6-yl)amino]-N-[(E)-[2-(trifluoromethyl)phenyl]methylideneamino]acetamide | 2 - 2-[(3,5-dioxo-2H-1,2,4-triazin-6-yl)amino]-N-[(E)-[2-(trifluoromethyl)phenyl]methylideneamino]acetamide