| MolName | N-[(Z)-(1,2-diphenylindol-3-yl)methylideneamino]-2-thiophen-2-ylquinoline-4-carboxamide |
| MolecularFormula | C35H24N4OS |
| Smiles | O=C(c1cc(-c2cccs2)nc2ccccc12)N/N=C\c(c1c2cccc1)c(-c1ccccc1)n2-c1ccccc1 |
| InChI | InChI=1S/C35H24N4OS/c40-35(28-22-31(33-20-11-21-41-33)37-30-18-9-7-16-26(28)30)38-36-23-29-27-17-8-10-19-32(27)39(25-14-5-2-6-15-25)34(29)24-12-3-1-4-13-24/h1-23H,(H,38,40) |
| InChIK | RGNZETRLMIVDPV-UHFFFAOYSA-N |
| TotalMolweight | 548.669 |
| Molweight | 548.669 |
| MonoisotopicMass | 548.167081 |
| CLogP | 8.5433 |
| CLogS | -11.718 |
| H Acceptors | 5 |
| H Donors | 1 |
| TotalSurfaceArea | 419.37 |
| Relative PSA | 0.17696 |
| PolarSurfaceArea | 87.52 |
| Druglikeness | 6.8143 |
| Mutagenic | none |
| Tumorigenic | high |
| Reproductive Effective | high |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.41463 |
| Fragments | 1 |
| Non HAtoms | 41 |
| NonCHAtoms | 6 |
| Electronegative Atoms | 6 |
| Rotatable Bond | 6 |
| Rings Closures | 7 |
| Small Rings | 7 |
| Aromatic Rings | 7 |
| Aromatic Atoms | 36 |
| Symmetricatoms | 4 |
| Aromatic Nitrogens | 2 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-(1,2-diphenylindol-3-yl)methylideneamino]-2-thiophen-2-ylquinoline-4-carboxamide | 2 - N-[(Z)-(1,2-diphenylindol-3-yl)methylideneamino]-2-thiophen-2-ylquinoline-4-carboxamide