| MolName | 4,6-dimorpholin-4-yl-N-[(Z)-[1-(3-nitrophenyl)pyrrol-2-yl]methylideneamino]-1,3,5-triazin-2-amine |
| MolecularFormula | C22H25N9O4 |
| Smiles | [O-][N+](c1cc(-n2c(/C=N\Nc3nc(N4CCOCC4)nc(N4CCOCC4)n3)ccc2)ccc1)=O |
| InChI | InChI=1S/C22H25N9O4/c32-31(33)18-4-1-3-17(15-18)30-6-2-5-19(30)16-23-27-20-24-21(28-7-11-34-12-8-28)26-22(25-20)29-9-13-35-14-10-29/h1-6,15-16H,7-14H2,(H,24,25,26,27) |
| InChIK | RGPZYDLBODNWMW-UHFFFAOYSA-N |
| TotalMolweight | 479.5 |
| Molweight | 479.5 |
| MonoisotopicMass | 479.202951 |
| CLogP | 2.4066 |
| CLogS | -6.338 |
| H Acceptors | 13 |
| H Donors | 1 |
| TotalSurfaceArea | 361.83 |
| Relative PSA | 0.33239 |
| PolarSurfaceArea | 138.75 |
| Druglikeness | -1.1713 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | high |
| Irritant | high |
| Nasty Functions | aromatic nitro; imine/hydrazone of aldehyde |
| Shape Index | 0.48571 |
| Fragments | 1 |
| Non HAtoms | 35 |
| NonCHAtoms | 13 |
| Electronegative Atoms | 13 |
| Rotatable Bond | 7 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 17 |
| Sp3Atoms | 11 |
| Symmetricatoms | 10 |
| Aromatic Nitrogens | 4 |
| BasicNitrogens | 3 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 4,6-dimorpholin-4-yl-N-[(Z)-[1-(3-nitrophenyl)pyrrol-2-yl]methylideneamino]-1,3,5-triazin-2-amine | 2 - 4,6-dimorpholin-4-yl-N-[(Z)-[1-(3-nitrophenyl)pyrrol-2-yl]methylideneamino]-1,3,5-triazin-2-amine