| MolName | N-[(Z)-naphthalen-1-ylmethylideneamino]-3-piperidin-1-ylsulfonylbenzamide |
| MolecularFormula | C23H23N3O3S |
| Smiles | O=C(c1cccc(S(N2CCCCC2)(=O)=O)c1)N/N=C\c1cccc2ccccc12 |
| InChI | InChI=1S/C23H23N3O3S/c27-23(25-24-17-20-11-6-9-18-8-2-3-13-22(18)20)19-10-7-12-21(16-19)30(28,29)26-14-4-1-5-15-26/h2-3,6-13,16-17H,1,4-5,14-15H2,(H,25,27) |
| InChIK | RGRYZVKGSLOPLL-UHFFFAOYSA-N |
| TotalMolweight | 421.52 |
| Molweight | 421.52 |
| MonoisotopicMass | 421.146012 |
| CLogP | 4.6028 |
| CLogS | -5.422 |
| H Acceptors | 6 |
| H Donors | 1 |
| TotalSurfaceArea | 315.77 |
| Relative PSA | 0.21579 |
| PolarSurfaceArea | 87.22 |
| Druglikeness | -1.1043 |
| Mutagenic | none |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.56667 |
| Fragments | 1 |
| Non HAtoms | 30 |
| NonCHAtoms | 7 |
| Electronegative Atoms | 7 |
| Rotatable Bond | 4 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 16 |
| Sp3Atoms | 6 |
| Symmetricatoms | 3 |
| Amides | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-naphthalen-1-ylmethylideneamino]-3-piperidin-1-ylsulfonylbenzamide | 2 - N-[(Z)-naphthalen-1-ylmethylideneamino]-3-piperidin-1-ylsulfonylbenzamide