| MolName | (Z,Z)-2-chloro-3-phenyl-N-(4-phenylpiperazin-1-yl)prop-2-en-1-imine |
| MolecularFormula | C19H20N3Cl |
| Smiles | Cl/C(/C=N\N(CC1)CCN1c1ccccc1)=C\c1ccccc1 |
| InChI | InChI=1S/C19H20ClN3/c20-18(15-17-7-3-1-4-8-17)16-21-23-13-11-22(12-14-23)19-9-5-2-6-10-19/h1-10,15-16H,11-14H2 |
| InChIK | RGTKOSWKGIVYRM-UHFFFAOYSA-N |
| TotalMolweight | 325.842 |
| Molweight | 325.842 |
| MonoisotopicMass | 325.134574 |
| CLogP | 3.576 |
| CLogS | -4.161 |
| H Acceptors | 3 |
| TotalSurfaceArea | 260.05 |
| Relative PSA | 0.071563 |
| PolarSurfaceArea | 18.84 |
| Druglikeness | 6.566 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.69565 |
| Fragments | 1 |
| Non HAtoms | 23 |
| NonCHAtoms | 4 |
| Electronegative Atoms | 4 |
| Rotatable Bond | 4 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 5 |
| Symmetricatoms | 6 |
| Amines | 1 |
| Aromatic Amines | 1 |
| StereoCon |
Click to Load Molecule:
1 - (Z,Z)-2-chloro-3-phenyl-N-(4-phenylpiperazin-1-yl)prop-2-en-1-imine | 2 - (Z,Z)-2-chloro-3-phenyl-N-(4-phenylpiperazin-1-yl)prop-2-en-1-imine