| MolName | N-[(Z)-(2,4-dichlorophenyl)methylideneamino]-2-[[5-(naphthalen-1-ylmethylsulfanyl)-1,3,4-thiadiazol-2-yl]sulfanyl]acetamide |
| MolecularFormula | C22H16N4OCl2S3 |
| Smiles | O=C(CSc1nnc(SCc2cccc3ccccc23)s1)N/N=C\c(ccc(Cl)c1)c1Cl |
| InChI | InChI=1S/C22H16Cl2N4OS3/c23-17-9-8-15(19(24)10-17)11-25-26-20(29)13-31-22-28-27-21(32-22)30-12-16-6-3-5-14-4-1-2-7-18(14)16/h1-11H,12-13H2,(H,26,29) |
| InChIK | RGTRFKQUPSPIIK-UHFFFAOYSA-N |
| TotalMolweight | 519.5 |
| Molweight | 519.5 |
| MonoisotopicMass | 517.986325 |
| CLogP | 6.8194 |
| CLogS | -9.418 |
| H Acceptors | 5 |
| H Donors | 1 |
| TotalSurfaceArea | 368.15 |
| Relative PSA | 0.30773 |
| PolarSurfaceArea | 146.08 |
| Druglikeness | 5.15 |
| Mutagenic | low |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.65625 |
| Fragments | 1 |
| Non HAtoms | 32 |
| NonCHAtoms | 10 |
| Electronegative Atoms | 10 |
| Rotatable Bond | 8 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 21 |
| Sp3Atoms | 4 |
| Aromatic Nitrogens | 2 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-(2,4-dichlorophenyl)methylideneamino]-2-[[5-(naphthalen-1-ylmethylsulfanyl)-1,3,4-thiadiazol-2-yl]sulfanyl]acetamide | 2 - N-[(Z)-(2,4-dichlorophenyl)methylideneamino]-2-[[5-(naphthalen-1-ylmethylsulfanyl)-1,3,4-thiadiazol-2-yl]sulfanyl]acetamide