| MolName | 3-(4-amino-1,2,5-oxadiazol-3-yl)-5-(piperidin-1-ylmethyl)-N-[(Z)-[4-(trifluoromethyl)phenyl]methylideneamino]triazole-4-carboxamide |
| MolecularFormula | C19H20N9O2F3 |
| Smiles | Nc1nonc1-n1nnc(CN2CCCCC2)c1C(N/N=C\c1ccc(C(F)(F)F)cc1)=O |
| InChI | InChI=1S/C19H20F3N9O2/c20-19(21,22)13-6-4-12(5-7-13)10-24-26-18(32)15-14(11-30-8-2-1-3-9-30)25-29-31(15)17-16(23)27-33-28-17/h4-7,10H,1-3,8-9,11H2,(H2,23,27)(H,26,32) |
| InChIK | RGZDBWYVQMQDGZ-UHFFFAOYSA-N |
| TotalMolweight | 463.423 |
| Molweight | 463.423 |
| MonoisotopicMass | 463.169205 |
| CLogP | 3.3536 |
| CLogS | -2.7 |
| H Acceptors | 11 |
| H Donors | 2 |
| TotalSurfaceArea | 338.02 |
| Relative PSA | 0.35409 |
| PolarSurfaceArea | 140.35 |
| Druglikeness | -5.4004 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.51515 |
| Fragments | 1 |
| Non HAtoms | 33 |
| NonCHAtoms | 14 |
| Electronegative Atoms | 14 |
| Rotatable Bond | 7 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 16 |
| Sp3Atoms | 8 |
| Symmetricatoms | 6 |
| Amines | 1 |
| AlkylAmines | 1 |
| Aromatic Nitrogens | 5 |
| BasicNitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 3-(4-amino-1,2,5-oxadiazol-3-yl)-5-(piperidin-1-ylmethyl)-N-[(Z)-[4-(trifluoromethyl)phenyl]methylideneamino]triazole-4-carboxamide | 2 - 3-(4-amino-1,2,5-oxadiazol-3-yl)-5-(piperidin-1-ylmethyl)-N-[(Z)-[4-(trifluoromethyl)phenyl]methylideneamino]triazole-4-carboxamide