| MolName | 6-chloro-N-[(Z)-(2-chloro-6-fluorophenyl)methylideneamino]pyridin-2-amine |
| MolecularFormula | C12H8N3Cl2F |
| Smiles | Fc1cccc(Cl)c1/C=N\Nc1cccc(Cl)n1 |
| InChI | InChI=1S/C12H8Cl2FN3/c13-9-3-1-4-10(15)8(9)7-16-18-12-6-2-5-11(14)17-12/h1-7H,(H,17,18) |
| InChIK | RHIMAGMPLKGOGL-UHFFFAOYSA-N |
| TotalMolweight | 284.121 |
| Molweight | 284.121 |
| MonoisotopicMass | 283.007929 |
| CLogP | 5.6016 |
| CLogS | -4.428 |
| H Acceptors | 3 |
| H Donors | 1 |
| TotalSurfaceArea | 205.19 |
| Relative PSA | 0.16541 |
| PolarSurfaceArea | 37.28 |
| Druglikeness | 1.0445 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.61111 |
| Fragments | 1 |
| Non HAtoms | 18 |
| NonCHAtoms | 6 |
| Electronegative Atoms | 6 |
| Rotatable Bond | 3 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Aromatic Nitrogens | 1 |
| BasicNitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 6-chloro-N-[(Z)-(2-chloro-6-fluorophenyl)methylideneamino]pyridin-2-amine | 2 - 6-chloro-N-[(Z)-(2-chloro-6-fluorophenyl)methylideneamino]pyridin-2-amine