| MolName | N-[2-oxo-2-[(2Z)-2-(pyridin-3-ylmethylidene)hydrazinyl]ethyl]-2,2-diphenylacetamide |
| MolecularFormula | C22H20N4O2 |
| Smiles | O=C(CNC(C(c1ccccc1)c1ccccc1)=O)N/N=C\c1cnccc1 |
| InChI | InChI=1S/C22H20N4O2/c27-20(26-25-15-17-8-7-13-23-14-17)16-24-22(28)21(18-9-3-1-4-10-18)19-11-5-2-6-12-19/h1-15,21H,16H2,(H,24,28)(H,26,27) |
| InChIK | RIABCKZFFZHIHH-UHFFFAOYSA-N |
| TotalMolweight | 372.427 |
| Molweight | 372.427 |
| MonoisotopicMass | 372.158626 |
| CLogP | 2.8101 |
| CLogS | -3.807 |
| H Acceptors | 6 |
| H Donors | 2 |
| TotalSurfaceArea | 300.98 |
| Relative PSA | 0.23749 |
| PolarSurfaceArea | 83.45 |
| Druglikeness | 6.3152 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.57143 |
| Fragments | 1 |
| Non HAtoms | 28 |
| NonCHAtoms | 6 |
| Electronegative Atoms | 6 |
| Rotatable Bond | 7 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Sp3Atoms | 2 |
| Symmetricatoms | 8 |
| Amides | 1 |
| Aromatic Nitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-[2-oxo-2-[(2Z)-2-(pyridin-3-ylmethylidene)hydrazinyl]ethyl]-2,2-diphenylacetamide | 2 - N-[2-oxo-2-[(2Z)-2-(pyridin-3-ylmethylidene)hydrazinyl]ethyl]-2,2-diphenylacetamide