| MolName | N,4-bis[(Z)-(4-morpholin-4-yl-3-nitrophenyl)methylideneamino]-1,2,4-triazol-3-amine |
| MolecularFormula | C24H26N10O6 |
| Smiles | [O-][N+](c(cc(/C=N\Nc1nncn1/N=C\c(cc1)cc([N+]([O-])=O)c1N1CCOCC1)cc1)c1N1CCOCC1)=O |
| InChI | InChI=1S/C24H26N10O6/c35-33(36)22-13-18(1-3-20(22)30-5-9-39-10-6-30)15-25-28-24-29-26-17-32(24)27-16-19-2-4-21(23(14-19)34(37)38)31-7-11-40-12-8-31/h1-4,13-17H,5-12H2,(H,28,29) |
| InChIK | RIJVYAAKKBEJKV-UHFFFAOYSA-N |
| TotalMolweight | 550.534 |
| Molweight | 550.534 |
| MonoisotopicMass | 550.20368 |
| CLogP | 2.3704 |
| CLogS | -7.24 |
| H Acceptors | 16 |
| H Donors | 1 |
| TotalSurfaceArea | 411.5 |
| Relative PSA | 0.36751 |
| PolarSurfaceArea | 184.04 |
| Druglikeness | -0.23514 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | low |
| Irritant | none |
| Nasty Functions | aromatic nitro; imine/hydrazone of aldehyde |
| Shape Index | 0.575 |
| Fragments | 1 |
| Non HAtoms | 40 |
| NonCHAtoms | 16 |
| Electronegative Atoms | 16 |
| Rotatable Bond | 9 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 17 |
| Sp3Atoms | 14 |
| Symmetricatoms | 4 |
| Amines | 2 |
| Aromatic Amines | 2 |
| Aromatic Nitrogens | 3 |
| BasicNitrogens | 1 |
| AcidicOxygens | 2 |
| StereoCon |
Click to Load Molecule:
1 - N,4-bis[(Z)-(4-morpholin-4-yl-3-nitrophenyl)methylideneamino]-1,2,4-triazol-3-amine | 2 - N,4-bis[(Z)-(4-morpholin-4-yl-3-nitrophenyl)methylideneamino]-1,2,4-triazol-3-amine