| MolName | 1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(Z)-[1-(2-amino-2-oxoethyl)-3-phenylpyrazol-4-yl]methylideneamino]-5-(2,3-dihydroindol-1-ylmethyl)triazole-4-carboxamide |
| MolecularFormula | C26H24N12O3 |
| Smiles | NC(Cn(cc1/C=N\NC(c2c(CN(CC3)c4c3cccc4)n(-c3nonc3N)nn2)=O)nc1-c1ccccc1)=O |
| InChI | InChI=1S/C26H24N12O3/c27-21(39)15-37-13-18(22(32-37)17-7-2-1-3-8-17)12-29-31-26(40)23-20(38(35-30-23)25-24(28)33-41-34-25)14-36-11-10-16-6-4-5-9-19(16)36/h1-9,12-13H,10-11,14-15H2,(H2,27,39)(H2,28,33)(H,31,40) |
| InChIK | RIJYBDBSZQRPRK-UHFFFAOYSA-N |
| TotalMolweight | 552.558 |
| Molweight | 552.558 |
| MonoisotopicMass | 552.209433 |
| CLogP | 1.5957 |
| CLogS | -3.261 |
| H Acceptors | 15 |
| H Donors | 3 |
| TotalSurfaceArea | 414.79 |
| Relative PSA | 0.39982 |
| PolarSurfaceArea | 201.26 |
| Druglikeness | 4.9171 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.43902 |
| Fragments | 1 |
| Non HAtoms | 41 |
| NonCHAtoms | 15 |
| Electronegative Atoms | 15 |
| Rotatable Bond | 9 |
| Rings Closures | 6 |
| Small Rings | 6 |
| Aromatic Rings | 5 |
| Aromatic Atoms | 27 |
| Sp3Atoms | 5 |
| Symmetricatoms | 2 |
| Amides | 1 |
| Amines | 1 |
| Aromatic Amines | 1 |
| Aromatic Nitrogens | 7 |
| StereoCon |
Click to Load Molecule:
1 - 1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(Z)-[1-(2-amino-2-oxoethyl)-3-phenylpyrazol-4-yl]methylideneamino]-5-(2,3-dihydroindol-1-ylmethyl)triazole-4-carboxamide | 2 - 1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(Z)-[1-(2-amino-2-oxoethyl)-3-phenylpyrazol-4-yl]methylideneamino]-5-(2,3-dihydroindol-1-ylmethyl)triazole-4-carboxamide