| MolName | N-[(Z)-benzylideneamino]-N-phenylbenzamide |
| MolecularFormula | C20H16N2O |
| Smiles | O=C(c1ccccc1)N(c1ccccc1)/N=C\c1ccccc1 |
| InChI | InChI=1S/C20H16N2O/c23-20(18-12-6-2-7-13-18)22(19-14-8-3-9-15-19)21-16-17-10-4-1-5-11-17/h1-16H |
| InChIK | RILJYNNESBKLPN-UHFFFAOYSA-N |
| TotalMolweight | 300.36 |
| Molweight | 300.36 |
| MonoisotopicMass | 300.126263 |
| CLogP | 5.0542 |
| CLogS | -4.431 |
| H Acceptors | 3 |
| TotalSurfaceArea | 245.59 |
| Relative PSA | 0.11442 |
| PolarSurfaceArea | 32.67 |
| Druglikeness | 3.8425 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.52174 |
| Fragments | 1 |
| Non HAtoms | 23 |
| NonCHAtoms | 3 |
| Electronegative Atoms | 3 |
| Rotatable Bond | 4 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Symmetricatoms | 6 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-benzylideneamino]-N-phenylbenzamide | 2 - N-[(Z)-benzylideneamino]-N-phenylbenzamide