| MolName | 2-(5-amino-1,3,4-thiadiazol-2-yl)-N-[(Z)-[5-(4-chlorophenyl)sulfanylfuran-2-yl]methylideneamino]acetamide |
| MolecularFormula | C15H12N5O2ClS2 |
| Smiles | Nc1nnc(CC(N/N=C\c(o2)ccc2Sc(cc2)ccc2Cl)=O)s1 |
| InChI | InChI=1S/C15H12ClN5O2S2/c16-9-1-4-11(5-2-9)24-14-6-3-10(23-14)8-18-19-12(22)7-13-20-21-15(17)25-13/h1-6,8H,7H2,(H2,17,21)(H,19,22) |
| InChIK | RILUOSOJTSIBRD-UHFFFAOYSA-N |
| TotalMolweight | 393.878 |
| Molweight | 393.878 |
| MonoisotopicMass | 393.012092 |
| CLogP | 3.0786 |
| CLogS | -4.936 |
| H Acceptors | 7 |
| H Donors | 2 |
| TotalSurfaceArea | 285.09 |
| Relative PSA | 0.43909 |
| PolarSurfaceArea | 159.94 |
| Druglikeness | 7.7682 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.72 |
| Fragments | 1 |
| Non HAtoms | 25 |
| NonCHAtoms | 10 |
| Electronegative Atoms | 10 |
| Rotatable Bond | 6 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 16 |
| Sp3Atoms | 2 |
| Symmetricatoms | 2 |
| Aromatic Nitrogens | 2 |
| StereoCon |
Click to Load Molecule:
1 - 2-(5-amino-1,3,4-thiadiazol-2-yl)-N-[(Z)-[5-(4-chlorophenyl)sulfanylfuran-2-yl]methylideneamino]acetamide | 2 - 2-(5-amino-1,3,4-thiadiazol-2-yl)-N-[(Z)-[5-(4-chlorophenyl)sulfanylfuran-2-yl]methylideneamino]acetamide