| MolName | 2-(5-amino-1,3,4-thiadiazol-2-yl)-N-[(Z)-[2-[(2-chlorophenyl)methoxy]phenyl]methylideneamino]acetamide |
| MolecularFormula | C18H16N5O2ClS |
| Smiles | Nc1nnc(CC(N/N=C\c(cccc2)c2OCc(cccc2)c2Cl)=O)s1 |
| InChI | InChI=1S/C18H16ClN5O2S/c19-14-7-3-1-6-13(14)11-26-15-8-4-2-5-12(15)10-21-22-16(25)9-17-23-24-18(20)27-17/h1-8,10H,9,11H2,(H2,20,24)(H,22,25) |
| InChIK | RIRUVHNIZZWYKV-UHFFFAOYSA-N |
| TotalMolweight | 401.877 |
| Molweight | 401.877 |
| MonoisotopicMass | 401.071322 |
| CLogP | 3.3195 |
| CLogS | -5.046 |
| H Acceptors | 7 |
| H Donors | 2 |
| TotalSurfaceArea | 301.67 |
| Relative PSA | 0.34336 |
| PolarSurfaceArea | 130.73 |
| Druglikeness | 5.5404 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.62963 |
| Fragments | 1 |
| Non HAtoms | 27 |
| NonCHAtoms | 9 |
| Electronegative Atoms | 9 |
| Rotatable Bond | 7 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 17 |
| Sp3Atoms | 3 |
| Aromatic Nitrogens | 2 |
| StereoCon |
Click to Load Molecule:
1 - 2-(5-amino-1,3,4-thiadiazol-2-yl)-N-[(Z)-[2-[(2-chlorophenyl)methoxy]phenyl]methylideneamino]acetamide | 2 - 2-(5-amino-1,3,4-thiadiazol-2-yl)-N-[(Z)-[2-[(2-chlorophenyl)methoxy]phenyl]methylideneamino]acetamide