| MolName | 2-(4-chloro-2-nitrophenoxy)-N-[(Z)-[5-(3,4-dichlorophenyl)furan-2-yl]methylideneamino]acetamide |
| MolecularFormula | C19H12N3O5Cl3 |
| Smiles | [O-][N+](c(cc(cc1)Cl)c1OCC(N/N=C\c1ccc(-c(cc2)cc(Cl)c2Cl)o1)=O)=O |
| InChI | InChI=1S/C19H12Cl3N3O5/c20-12-2-5-18(16(8-12)25(27)28)29-10-19(26)24-23-9-13-3-6-17(30-13)11-1-4-14(21)15(22)7-11/h1-9H,10H2,(H,24,26) |
| InChIK | RJBRQYOJEUMVIQ-UHFFFAOYSA-N |
| TotalMolweight | 468.679 |
| Molweight | 468.679 |
| MonoisotopicMass | 466.984253 |
| CLogP | 4.6118 |
| CLogS | -7.629 |
| H Acceptors | 8 |
| H Donors | 1 |
| TotalSurfaceArea | 330.13 |
| Relative PSA | 0.27426 |
| PolarSurfaceArea | 109.65 |
| Druglikeness | 1.3799 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | high |
| Irritant | none |
| Nasty Functions | aromatic nitro; acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.63333 |
| Fragments | 1 |
| Non HAtoms | 30 |
| NonCHAtoms | 11 |
| Electronegative Atoms | 11 |
| Rotatable Bond | 7 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 17 |
| Sp3Atoms | 3 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 2-(4-chloro-2-nitrophenoxy)-N-[(Z)-[5-(3,4-dichlorophenyl)furan-2-yl]methylideneamino]acetamide | 2 - 2-(4-chloro-2-nitrophenoxy)-N-[(Z)-[5-(3,4-dichlorophenyl)furan-2-yl]methylideneamino]acetamide