| MolName | 3-[[4-chloro-2-oxo-5-[(Z)-[(2-phenoxyacetyl)hydrazinylidene]methyl]-1,3-thiazol-3-yl]methyl]benzoate |
| MolecularFormula | C20H15N3O5ClS |
| Smiles | [O-]C(c1cccc(CN(C(Cl)=C(/C=N\NC(COc2ccccc2)=O)S2)C2=O)c1)=O |
| InChI | InChI=1S/C20H16ClN3O5S/c21-18-16(10-22-23-17(25)12-29-15-7-2-1-3-8-15)30-20(28)24(18)11-13-5-4-6-14(9-13)19(26)27/h1-10H,11-12H2,(H,23,25)(H,26,27)/p-1 |
| InChIK | RJCKYOPHCILSDY-UHFFFAOYSA-M |
| TotalMolweight | 444.874 |
| Molweight | 444.874 |
| MonoisotopicMass | 444.042094 |
| CLogP | 0.5559 |
| CLogS | -5.121 |
| H Acceptors | 8 |
| H Donors | 1 |
| TotalSurfaceArea | 320.17 |
| Relative PSA | 0.33548 |
| PolarSurfaceArea | 136.43 |
| Druglikeness | 7.3588 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | polar activated DB; acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.63333 |
| Fragments | 1 |
| Non HAtoms | 30 |
| NonCHAtoms | 10 |
| Electronegative Atoms | 10 |
| Rotatable Bond | 8 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 5 |
| Symmetricatoms | 2 |
| Amides | 1 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 3-[[4-chloro-2-oxo-5-[(Z)-[(2-phenoxyacetyl)hydrazinylidene]methyl]-1,3-thiazol-3-yl]methyl]benzoate | 2 - 3-[[4-chloro-2-oxo-5-[(Z)-[(2-phenoxyacetyl)hydrazinylidene]methyl]-1,3-thiazol-3-yl]methyl]benzoate