| MolName | N-[(Z)-[4-[2-(4-fluoroanilino)-2-oxoethoxy]phenyl]methylideneamino]-2-(N-(2-nitrophenyl)sulfonylanilino)acetamide |
| MolecularFormula | C29H24N5O7FS |
| Smiles | [O-][N+](c(cccc1)c1S(N(CC(N/N=C\c(cc1)ccc1OCC(Nc(cc1)ccc1F)=O)=O)c1ccccc1)(=O)=O)=O |
| InChI | InChI=1S/C29H24FN5O7S/c30-22-12-14-23(15-13-22)32-29(37)20-42-25-16-10-21(11-17-25)18-31-33-28(36)19-34(24-6-2-1-3-7-24)43(40,41)27-9-5-4-8-26(27)35(38)39/h1-18H,19-20H2,(H,32,37)(H,33,36) |
| InChIK | RJEKZMKBWNCGNL-UHFFFAOYSA-N |
| TotalMolweight | 605.602 |
| Molweight | 605.602 |
| MonoisotopicMass | 605.138048 |
| CLogP | 2.9524 |
| CLogS | -6.992 |
| H Acceptors | 12 |
| H Donors | 2 |
| TotalSurfaceArea | 442.14 |
| Relative PSA | 0.30095 |
| PolarSurfaceArea | 171.37 |
| Druglikeness | -0.15118 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | aromatic nitro; acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.55814 |
| Fragments | 1 |
| Non HAtoms | 43 |
| NonCHAtoms | 14 |
| Electronegative Atoms | 14 |
| Rotatable Bond | 11 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 24 |
| Sp3Atoms | 5 |
| Symmetricatoms | 7 |
| Amides | 2 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-[4-[2-(4-fluoroanilino)-2-oxoethoxy]phenyl]methylideneamino]-2-(N-(2-nitrophenyl)sulfonylanilino)acetamide | 2 - N-[(Z)-[4-[2-(4-fluoroanilino)-2-oxoethoxy]phenyl]methylideneamino]-2-(N-(2-nitrophenyl)sulfonylanilino)acetamide