| MolName | 1-cyclohexyl-3-[(Z)-[3-(4-nitrophenyl)-1-phenylpyrazol-4-yl]methylideneamino]thiourea |
| MolecularFormula | C23H24N6O2S |
| Smiles | [O-][N+](c(cc1)ccc1-c(c(/C=N\NC(NC1CCCCC1)=S)c1)nn1-c1ccccc1)=O |
| InChI | InChI=1S/C23H24N6O2S/c30-29(31)21-13-11-17(12-14-21)22-18(16-28(27-22)20-9-5-2-6-10-20)15-24-26-23(32)25-19-7-3-1-4-8-19/h2,5-6,9-16,19H,1,3-4,7-8H2,(H2,25,26,32) |
| InChIK | RJOFVGHZRUOTKH-UHFFFAOYSA-N |
| TotalMolweight | 448.55 |
| Molweight | 448.55 |
| MonoisotopicMass | 448.168144 |
| CLogP | 3.4366 |
| CLogS | -6.361 |
| H Acceptors | 8 |
| H Donors | 2 |
| TotalSurfaceArea | 352.6 |
| Relative PSA | 0.31393 |
| PolarSurfaceArea | 132.15 |
| Druglikeness | -6.1778 |
| Mutagenic | high |
| Tumorigenic | none |
| Reproductive Effective | high |
| Irritant | none |
| Nasty Functions | aromatic nitro; imine/hydrazone of aldehyde; thio-amide/urea |
| Shape Index | 0.53125 |
| Fragments | 1 |
| Non HAtoms | 32 |
| NonCHAtoms | 9 |
| Electronegative Atoms | 9 |
| Rotatable Bond | 6 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 17 |
| Sp3Atoms | 8 |
| Symmetricatoms | 6 |
| Aromatic Nitrogens | 2 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 1-cyclohexyl-3-[(Z)-[3-(4-nitrophenyl)-1-phenylpyrazol-4-yl]methylideneamino]thiourea | 2 - 1-cyclohexyl-3-[(Z)-[3-(4-nitrophenyl)-1-phenylpyrazol-4-yl]methylideneamino]thiourea