| MolName | [3-(4-chlorobenzoyl)oxy-4-[(Z)-[[2-oxo-2-[(5-phenyl-1,3,4-thiadiazol-2-yl)amino]acetyl]hydrazinylidene]methyl]phenyl] 4-chlorobenzoate |
| MolecularFormula | C31H19N5O6Cl2S |
| Smiles | O=C(C(N/N=C\c(ccc(OC(c(cc1)ccc1Cl)=O)c1)c1OC(c(cc1)ccc1Cl)=O)=O)Nc1nnc(-c2ccccc2)s1 |
| InChI | InChI=1S/C31H19Cl2N5O6S/c32-22-11-6-19(7-12-22)29(41)43-24-15-10-21(25(16-24)44-30(42)20-8-13-23(33)14-9-20)17-34-36-27(40)26(39)35-31-38-37-28(45-31)18-4-2-1-3-5-18/h1-17H,(H,36,40)(H,35,38,39) |
| InChIK | RJOISTALVBAHFQ-UHFFFAOYSA-N |
| TotalMolweight | 660.493 |
| Molweight | 660.493 |
| MonoisotopicMass | 659.043309 |
| CLogP | 6.8849 |
| CLogS | -8.441 |
| H Acceptors | 11 |
| H Donors | 2 |
| TotalSurfaceArea | 475.28 |
| Relative PSA | 0.31327 |
| PolarSurfaceArea | 177.18 |
| Druglikeness | 4.8849 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde; limit! oxal-diamide |
| Shape Index | 0.53333 |
| Fragments | 1 |
| Non HAtoms | 45 |
| NonCHAtoms | 14 |
| Electronegative Atoms | 14 |
| Rotatable Bond | 11 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 5 |
| Aromatic Atoms | 29 |
| Sp3Atoms | 2 |
| Symmetricatoms | 6 |
| Amides | 1 |
| Aromatic Nitrogens | 2 |
| StereoCon |
Click to Load Molecule:
1 - [3-(4-chlorobenzoyl)oxy-4-[(Z)-[[2-oxo-2-[(5-phenyl-1,3,4-thiadiazol-2-yl)amino]acetyl]hydrazinylidene]methyl]phenyl] 4-chlorobenzoate | 2 - [3-(4-chlorobenzoyl)oxy-4-[(Z)-[[2-oxo-2-[(5-phenyl-1,3,4-thiadiazol-2-yl)amino]acetyl]hydrazinylidene]methyl]phenyl] 4-chlorobenzoate