| MolName | 4-cyano-N-[(Z)-[3,5-dichloro-4-(naphthalen-1-ylmethoxy)phenyl]methylideneamino]-2-fluorobenzamide |
| MolecularFormula | C26H16N3O2Cl2F |
| Smiles | N#Cc(cc1)cc(F)c1C(N/N=C\c(cc1Cl)cc(Cl)c1OCc1cccc2ccccc12)=O |
| InChI | InChI=1S/C26H16Cl2FN3O2/c27-22-10-17(14-31-32-26(33)21-9-8-16(13-30)12-24(21)29)11-23(28)25(22)34-15-19-6-3-5-18-4-1-2-7-20(18)19/h1-12,14H,15H2,(H,32,33) |
| InChIK | RJPSOKGBLAUUSQ-UHFFFAOYSA-N |
| TotalMolweight | 492.336 |
| Molweight | 492.336 |
| MonoisotopicMass | 491.060359 |
| CLogP | 6.8925 |
| CLogS | -9.227 |
| H Acceptors | 5 |
| H Donors | 1 |
| TotalSurfaceArea | 364.01 |
| Relative PSA | 0.16365 |
| PolarSurfaceArea | 74.48 |
| Druglikeness | -1.5686 |
| Mutagenic | low |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.61765 |
| Fragments | 1 |
| Non HAtoms | 34 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 6 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 22 |
| Sp3Atoms | 2 |
| Symmetricatoms | 3 |
| StereoCon |
Click to Load Molecule:
1 - 4-cyano-N-[(Z)-[3,5-dichloro-4-(naphthalen-1-ylmethoxy)phenyl]methylideneamino]-2-fluorobenzamide | 2 - 4-cyano-N-[(Z)-[3,5-dichloro-4-(naphthalen-1-ylmethoxy)phenyl]methylideneamino]-2-fluorobenzamide