| MolName | [(Z)-(2-iodophenyl)methylideneamino]urea |
| MolecularFormula | C8H8N3OI |
| Smiles | NC(N/N=C\c(cccc1)c1I)=O |
| InChI | InChI=1S/C8H8IN3O/c9-7-4-2-1-3-6(7)5-11-12-8(10)13/h1-5H,(H3,10,12,13) |
| InChIK | RKQQLARYEAHNLT-UHFFFAOYSA-N |
| TotalMolweight | 289.072 |
| Molweight | 289.072 |
| MonoisotopicMass | 288.97121 |
| CLogP | 1.5724 |
| CLogS | -3.83 |
| H Acceptors | 4 |
| H Donors | 2 |
| TotalSurfaceArea | 162.03 |
| Relative PSA | 0.31648 |
| PolarSurfaceArea | 67.48 |
| Druglikeness | 4.74 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.69231 |
| Fragments | 1 |
| Non HAtoms | 13 |
| NonCHAtoms | 5 |
| Electronegative Atoms | 5 |
| Rotatable Bond | 2 |
| Rings Closures | 1 |
| Small Rings | 1 |
| Aromatic Rings | 1 |
| Aromatic Atoms | 6 |
| Amides | 1 |
| StereoCon |
Click to Load Molecule:
1 - [(Z)-(2-iodophenyl)methylideneamino]urea | 2 - [(Z)-(2-iodophenyl)methylideneamino]urea