| MolName | (Z)-N-[3-[(4-chlorophenyl)methylsulfanyl]-5-propyl-1,2,4-triazol-4-yl]-1-(4-pentoxyphenyl)methanimine |
| MolecularFormula | C24H29N4OClS |
| Smiles | CCCCCOc1ccc(/C=N\n2c(SCc(cc3)ccc3Cl)nnc2CCC)cc1 |
| InChI | InChI=1S/C24H29ClN4OS/c1-3-5-6-16-30-22-14-10-19(11-15-22)17-26-29-23(7-4-2)27-28-24(29)31-18-20-8-12-21(25)13-9-20/h8-15,17H,3-7,16,18H2,1-2H3 |
| InChIK | RKVBZONGIHEAKZ-UHFFFAOYSA-N |
| TotalMolweight | 457.04 |
| Molweight | 457.04 |
| MonoisotopicMass | 456.175058 |
| CLogP | 6.8407 |
| CLogS | -8.429 |
| H Acceptors | 5 |
| TotalSurfaceArea | 368.01 |
| Relative PSA | 0.18426 |
| PolarSurfaceArea | 77.6 |
| Druglikeness | -4.8686 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.67742 |
| Fragments | 1 |
| Non HAtoms | 31 |
| NonCHAtoms | 7 |
| Electronegative Atoms | 7 |
| Rotatable Bond | 12 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 17 |
| Sp3Atoms | 11 |
| Symmetricatoms | 4 |
| Aromatic Nitrogens | 3 |
| StereoCon |
Click to Load Molecule:
1 - (Z)-N-[3-[(4-chlorophenyl)methylsulfanyl]-5-propyl-1,2,4-triazol-4-yl]-1-(4-pentoxyphenyl)methanimine | 2 - (Z)-N-[3-[(4-chlorophenyl)methylsulfanyl]-5-propyl-1,2,4-triazol-4-yl]-1-(4-pentoxyphenyl)methanimine